C22H33N3O3 — CID 70035392
(2R)-2-amino-1-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]-1,4-diazepan-1-yl]butan-1-one (PubChem CID 70035392) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is (2R)-2-amino-1-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]-1,4-diazepan-1-yl]butan-1-one.
| Compound Name | (2R)-2-amino-1-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]-1,4-diazepan-1-yl]butan-1-one |
|---|---|
| PubChem CID | 70035392 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | (2R)-2-amino-1-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]-1,4-diazepan-1-yl]butan-1-one |
| SMILES | CC[C@@H](N)C(=O)N1CCCN(CCCOc2ccc(C(=O)C3CC3)cc2)CC1 |
| InChI | InChI=1S/C22H33N3O3/c1-2-20(23)22(27)25-13-3-11-24(14-15-25)12-4-16-28-19-9-7-18(8-10-19)21(26)17-5-6-17/h7-10,17,20H,2-6,11-16,23H2,1H3/t20-/m1/s1 |
| InChIKey | MCNNPSXLLDEWDX-HXUWFJFHSA-N |
| XLogP | 2.32 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|