C28H35N3O4 — CID 18540008
N-[1-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]piperazin-1-yl]-1-oxopropan-2-yl]-2-methylbenzamide (PubChem CID 18540008) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-[1-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]piperazin-1-yl]-1-oxopropan-2-yl]-2-methylbenzamide.
| Compound Name | N-[1-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]piperazin-1-yl]-1-oxopropan-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 18540008 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | N-[1-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]piperazin-1-yl]-1-oxopropan-2-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NC(C)C(=O)N1CCN(CCCOc2ccc(C(=O)C3CC3)cc2)CC1 |
| InChI | InChI=1S/C28H35N3O4/c1-20-6-3-4-7-25(20)27(33)29-21(2)28(34)31-17-15-30(16-18-31)14-5-19-35-24-12-10-23(11-13-24)26(32)22-8-9-22/h3-4,6-7,10-13,21-22H,5,8-9,14-19H2,1-2H3,(H,29,33) |
| InChIKey | WKOWPALXDXSDMK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|