C27H41N3O5 — CID 91544974
tert-butyl N-[(2R)-1-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]-1,4-diazepan-1-yl]-1-oxobutan-2-yl]carbamate (PubChem CID 91544974) has the molecular formula C27H41N3O5 and a molecular weight of 487.64 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]-1,4-diazepan-1-yl]-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]-1,4-diazepan-1-yl]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 91544974 |
| Molecular Formula | C27H41N3O5 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | tert-butyl N-[(2R)-1-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]-1,4-diazepan-1-yl]-1-oxobutan-2-yl]carbamate |
| SMILES | CC[C@@H](NC(=O)OC(C)(C)C)C(=O)N1CCCN(CCCOc2ccc(C(=O)C3CC3)cc2)CC1 |
| InChI | InChI=1S/C27H41N3O5/c1-5-23(28-26(33)35-27(2,3)4)25(32)30-16-6-14-29(17-18-30)15-7-19-34-22-12-10-21(11-13-22)24(31)20-8-9-20/h10-13,20,23H,5-9,14-19H2,1-4H3,(H,28,33)/t23-/m1/s1 |
| InChIKey | IBOAKSODFRFORN-HSZRJFAPSA-N |
| XLogP | 3.89 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|