C26H39N3O5 — CID 18539997
tert-butyl N-[3-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]-1,4-diazepan-1-yl]-3-oxopropyl]carbamate (PubChem CID 18539997) has the molecular formula C26H39N3O5 and a molecular weight of 473.61 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]-1,4-diazepan-1-yl]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]-1,4-diazepan-1-yl]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 18539997 |
| Molecular Formula | C26H39N3O5 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | tert-butyl N-[3-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]-1,4-diazepan-1-yl]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)N1CCCN(CCCOc2ccc(C(=O)C3CC3)cc2)CC1 |
| InChI | InChI=1S/C26H39N3O5/c1-26(2,3)34-25(32)27-13-12-23(30)29-16-4-14-28(17-18-29)15-5-19-33-22-10-8-21(9-11-22)24(31)20-6-7-20/h8-11,20H,4-7,12-19H2,1-3H3,(H,27,32) |
| InChIKey | GBTZWEDFBOMOAX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|