C26H37N3O5 — CID 18540093
tert-butyl 3-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]piperazine-1-carbonyl]azetidine-1-carboxylate (PubChem CID 18540093) has the molecular formula C26H37N3O5 and a molecular weight of 471.60 g/mol. Its IUPAC name is tert-butyl 3-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]piperazine-1-carbonyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]piperazine-1-carbonyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 18540093 |
| Molecular Formula | C26H37N3O5 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | tert-butyl 3-[4-[3-[4-(cyclopropanecarbonyl)phenoxy]propyl]piperazine-1-carbonyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C(=O)N2CCN(CCCOc3ccc(C(=O)C4CC4)cc3)CC2)C1 |
| InChI | InChI=1S/C26H37N3O5/c1-26(2,3)34-25(32)29-17-21(18-29)24(31)28-14-12-27(13-15-28)11-4-16-33-22-9-7-20(8-10-22)23(30)19-5-6-19/h7-10,19,21H,4-6,11-18H2,1-3H3 |
| InChIKey | CAGXQGGZWZGUPI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|