C25H39N3O4 — CID 90928404
tert-butyl 2,2,3,3,7,7-hexadeuterio-4-[4-(3-piperidin-1-ylpropoxy)benzoyl]-1,4-diazepane-1-carboxylate (PubChem CID 90928404) has the molecular formula C25H39N3O4 and a molecular weight of 451.64 g/mol. Its IUPAC name is tert-butyl 2,2,3,3,7,7-hexadeuterio-4-[4-(3-piperidin-1-ylpropoxy)benzoyl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 2,2,3,3,7,7-hexadeuterio-4-[4-(3-piperidin-1-ylpropoxy)benzoyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 90928404 |
| Molecular Formula | C25H39N3O4 |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.33 |
| IUPAC Name | tert-butyl 2,2,3,3,7,7-hexadeuterio-4-[4-(3-piperidin-1-ylpropoxy)benzoyl]-1,4-diazepane-1-carboxylate |
| SMILES | [2H]C1([2H])CCN(C(=O)c2ccc(OCCCN3CCCCC3)cc2)C([2H])([2H])C([2H])([2H])N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H39N3O4/c1-25(2,3)32-24(30)28-17-7-16-27(18-19-28)23(29)21-9-11-22(12-10-21)31-20-8-15-26-13-5-4-6-14-26/h9-12H,4-8,13-20H2,1-3H3/i17D2,18D2,19D2 |
| InChIKey | KEFKQBJNXFFPSU-SCCRQGQWSA-N |
| XLogP | 4.02 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|