C24H40N4O2 — CID 142171815
[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-pyrrolidin-1-ylmethanone;1-methylpyrrolidine (PubChem CID 142171815) has the molecular formula C24H40N4O2 and a molecular weight of 416.61 g/mol. Its IUPAC name is [4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-pyrrolidin-1-ylmethanone;1-methylpyrrolidine.
| Compound Name | [4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-pyrrolidin-1-ylmethanone;1-methylpyrrolidine |
|---|---|
| PubChem CID | 142171815 |
| Molecular Formula | C24H40N4O2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.32 |
| IUPAC Name | [4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-pyrrolidin-1-ylmethanone;1-methylpyrrolidine |
| SMILES | CN1CCCC1.CN1CCN(CCCOc2ccc(C(=O)N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C19H29N3O2.C5H11N/c1-20-12-14-21(15-13-20)9-4-16-24-18-7-5-17(6-8-18)19(23)22-10-2-3-11-22;1-6-4-2-3-5-6/h5-8H,2-4,9-16H2,1H3;2-5H2,1H3 |
| InChIKey | DZPLDUSSMFQKJM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|