About [4-(2-chloroethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-ethylpyrrolidine
[4-(2-chloroethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-ethylpyrrolidine (PubChem CID 143297647) has the molecular formula C19H29ClN2O2
and a molecular weight of 352.91 g/mol. Its IUPAC name is [4-(2-chloroethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-ethylpyrrolidine.
Molecular Properties
| Compound Name | [4-(2-chloroethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-ethylpyrrolidine |
| PubChem CID | 143297647 |
| Molecular Formula | C19H29ClN2O2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | [4-(2-chloroethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-ethylpyrrolidine |
| SMILES | CCN1CCCC1.O=C(c1ccc(OCCCl)cc1)N1CCCC1 |
| InChI | InChI=1S/C13H16ClNO2.C6H13N/c14-7-10-17-12-5-3-11(4-6-12)13(16)15-8-1-2-9-15;1-2-7-5-3-4-6-7/h3-6H,1-2,7-10H2;2-6H2,1H3 |
| InChIKey | CVXYHRCOJATUKL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-chloroethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-ethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-chloroethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-ethylpyrrolidine?
The IUPAC name of [4-(2-chloroethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-ethylpyrrolidine (CID 143297647) is [4-(2-chloroethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-ethylpyrrolidine.
What is the SMILES notation for [4-(2-chloroethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-ethylpyrrolidine?
The canonical SMILES for [4-(2-chloroethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-ethylpyrrolidine is CCN1CCCC1.O=C(c1ccc(OCCCl)cc1)N1CCCC1.
What is the InChIKey of [4-(2-chloroethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-ethylpyrrolidine?
The InChIKey is CVXYHRCOJATUKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO2.C6H13N/c14-7-10-17-12-5-3-11(4-6-12)13(16)15-8-1-2-9-15;1-2-7-5-3-4-6-7/h3-6H,1-2,7-10H2;2-6H2,1H3.
What are the key properties of [4-(2-chloroethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-ethylpyrrolidine?
[4-(2-chloroethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-ethylpyrrolidine has a molecular weight of 352.91 g/mol, XLogP of 3.64, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-chloroethoxy)phenyl]-pyrrolidin-1-ylmethanone;1-ethylpyrrolidine is sourced from PubChem (CID 143297647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).