C21H26N2O2 — CID 134813184
(4-ethyl-1,4-diazepan-1-yl)-[4-(phenoxymethyl)phenyl]methanone (PubChem CID 134813184) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (4-ethyl-1,4-diazepan-1-yl)-[4-(phenoxymethyl)phenyl]methanone.
| Compound Name | (4-ethyl-1,4-diazepan-1-yl)-[4-(phenoxymethyl)phenyl]methanone |
|---|---|
| PubChem CID | 134813184 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (4-ethyl-1,4-diazepan-1-yl)-[4-(phenoxymethyl)phenyl]methanone |
| SMILES | CCN1CCCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C21H26N2O2/c1-2-22-13-6-14-23(16-15-22)21(24)19-11-9-18(10-12-19)17-25-20-7-4-3-5-8-20/h3-5,7-12H,2,6,13-17H2,1H3 |
| InChIKey | CBPOXDZUUXSRQQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |