C23H28N2O4 — CID 129008282
2-[methyl-[1-[4-(phenoxymethyl)benzoyl]azepan-4-yl]amino]acetic acid (PubChem CID 129008282) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-[methyl-[1-[4-(phenoxymethyl)benzoyl]azepan-4-yl]amino]acetic acid.
| Compound Name | 2-[methyl-[1-[4-(phenoxymethyl)benzoyl]azepan-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 129008282 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2-[methyl-[1-[4-(phenoxymethyl)benzoyl]azepan-4-yl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C1CCCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C23H28N2O4/c1-24(16-22(26)27)20-6-5-14-25(15-13-20)23(28)19-11-9-18(10-12-19)17-29-21-7-3-2-4-8-21/h2-4,7-12,20H,5-6,13-17H2,1H3,(H,26,27) |
| InChIKey | ZLBWBGVAJMAOFR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |