C22H28N2O3 — CID 122042919
2-[methyl-[1-[(3-phenylmethoxyphenyl)methyl]piperidin-4-yl]amino]acetic acid (PubChem CID 122042919) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-[methyl-[1-[(3-phenylmethoxyphenyl)methyl]piperidin-4-yl]amino]acetic acid.
| Compound Name | 2-[methyl-[1-[(3-phenylmethoxyphenyl)methyl]piperidin-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 122042919 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 2-[methyl-[1-[(3-phenylmethoxyphenyl)methyl]piperidin-4-yl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C1CCN(Cc2cccc(OCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C22H28N2O3/c1-23(16-22(25)26)20-10-12-24(13-11-20)15-19-8-5-9-21(14-19)27-17-18-6-3-2-4-7-18/h2-9,14,20H,10-13,15-17H2,1H3,(H,25,26) |
| InChIKey | PNHBVDLXMQCHHU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |