C19H24N2O2 — CID 122042974
2-[methyl-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]amino]acetic acid (PubChem CID 122042974) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-[methyl-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]amino]acetic acid.
| Compound Name | 2-[methyl-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 122042974 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 2-[methyl-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C1CCN(Cc2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C19H24N2O2/c1-20(14-19(22)23)18-8-10-21(11-9-18)13-15-6-7-16-4-2-3-5-17(16)12-15/h2-7,12,18H,8-11,13-14H2,1H3,(H,22,23) |
| InChIKey | RANFSEXHCHPMHJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |