C21H27N3O3 — CID 122000969
2-[methyl-[1-(naphthalen-2-ylmethylcarbamoyl)azepan-4-yl]amino]acetic acid (PubChem CID 122000969) has the molecular formula C21H27N3O3 and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-[methyl-[1-(naphthalen-2-ylmethylcarbamoyl)azepan-4-yl]amino]acetic acid.
| Compound Name | 2-[methyl-[1-(naphthalen-2-ylmethylcarbamoyl)azepan-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 122000969 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 2-[methyl-[1-(naphthalen-2-ylmethylcarbamoyl)azepan-4-yl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C1CCCN(C(=O)NCc2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C21H27N3O3/c1-23(15-20(25)26)19-7-4-11-24(12-10-19)21(27)22-14-16-8-9-17-5-2-3-6-18(17)13-16/h2-3,5-6,8-9,13,19H,4,7,10-12,14-15H2,1H3,(H,22,27)(H,25,26) |
| InChIKey | QJKAWQCUNNSMGH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |