C19H35N3O3 — CID 122009154
2-[methyl-[1-[(1-methylcycloheptyl)methylcarbamoyl]azepan-4-yl]amino]acetic acid (PubChem CID 122009154) has the molecular formula C19H35N3O3 and a molecular weight of 353.51 g/mol. Its IUPAC name is 2-[methyl-[1-[(1-methylcycloheptyl)methylcarbamoyl]azepan-4-yl]amino]acetic acid.
| Compound Name | 2-[methyl-[1-[(1-methylcycloheptyl)methylcarbamoyl]azepan-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 122009154 |
| Molecular Formula | C19H35N3O3 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | 2-[methyl-[1-[(1-methylcycloheptyl)methylcarbamoyl]azepan-4-yl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C1CCCN(C(=O)NCC2(C)CCCCCC2)CC1 |
| InChI | InChI=1S/C19H35N3O3/c1-19(10-5-3-4-6-11-19)15-20-18(25)22-12-7-8-16(9-13-22)21(2)14-17(23)24/h16H,3-15H2,1-2H3,(H,20,25)(H,23,24) |
| InChIKey | WXZAPBBQFPHPTL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |