C18H33N3O3S — CID 122005464
2-[[1-[(2-ethylsulfanylcyclohexyl)carbamoyl]azepan-4-yl]-methylamino]acetic acid (PubChem CID 122005464) has the molecular formula C18H33N3O3S and a molecular weight of 371.55 g/mol. Its IUPAC name is 2-[[1-[(2-ethylsulfanylcyclohexyl)carbamoyl]azepan-4-yl]-methylamino]acetic acid.
| Compound Name | 2-[[1-[(2-ethylsulfanylcyclohexyl)carbamoyl]azepan-4-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 122005464 |
| Molecular Formula | C18H33N3O3S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 2-[[1-[(2-ethylsulfanylcyclohexyl)carbamoyl]azepan-4-yl]-methylamino]acetic acid |
| SMILES | CCSC1CCCCC1NC(=O)N1CCCC(N(C)CC(=O)O)CC1 |
| InChI | InChI=1S/C18H33N3O3S/c1-3-25-16-9-5-4-8-15(16)19-18(24)21-11-6-7-14(10-12-21)20(2)13-17(22)23/h14-16H,3-13H2,1-2H3,(H,19,24)(H,22,23) |
| InChIKey | LCVTXOSKTNUKLH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |