C20H37N3O3 — CID 122002488
2-[[1-(4-cyclohexylbutan-2-ylcarbamoyl)azepan-4-yl]-methylamino]acetic acid (PubChem CID 122002488) has the molecular formula C20H37N3O3 and a molecular weight of 367.53 g/mol. Its IUPAC name is 2-[[1-(4-cyclohexylbutan-2-ylcarbamoyl)azepan-4-yl]-methylamino]acetic acid.
| Compound Name | 2-[[1-(4-cyclohexylbutan-2-ylcarbamoyl)azepan-4-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 122002488 |
| Molecular Formula | C20H37N3O3 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.28 |
| IUPAC Name | 2-[[1-(4-cyclohexylbutan-2-ylcarbamoyl)azepan-4-yl]-methylamino]acetic acid |
| SMILES | CC(CCC1CCCCC1)NC(=O)N1CCCC(N(C)CC(=O)O)CC1 |
| InChI | InChI=1S/C20H37N3O3/c1-16(10-11-17-7-4-3-5-8-17)21-20(26)23-13-6-9-18(12-14-23)22(2)15-19(24)25/h16-18H,3-15H2,1-2H3,(H,21,26)(H,24,25) |
| InChIKey | YJYKNAVMODUTEQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |