C21H37N3O3 — CID 122011340
2-[methyl-[1-(spiro[5.5]undecan-3-ylcarbamoyl)azepan-4-yl]amino]acetic acid (PubChem CID 122011340) has the molecular formula C21H37N3O3 and a molecular weight of 379.55 g/mol. Its IUPAC name is 2-[methyl-[1-(spiro[5.5]undecan-3-ylcarbamoyl)azepan-4-yl]amino]acetic acid.
| Compound Name | 2-[methyl-[1-(spiro[5.5]undecan-3-ylcarbamoyl)azepan-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 122011340 |
| Molecular Formula | C21H37N3O3 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.28 |
| IUPAC Name | 2-[methyl-[1-(spiro[5.5]undecan-3-ylcarbamoyl)azepan-4-yl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C1CCCN(C(=O)NC2CCC3(CCCCC3)CC2)CC1 |
| InChI | InChI=1S/C21H37N3O3/c1-23(16-19(25)26)18-6-5-14-24(15-9-18)20(27)22-17-7-12-21(13-8-17)10-3-2-4-11-21/h17-18H,2-16H2,1H3,(H,22,27)(H,25,26) |
| InChIKey | STXZKQCOVBUBTC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |