About 4-(1,3-dioxolan-2-yl)-N-[(1R,2S)-2-ethylsulfanylcyclohexyl]piperidine-1-carboxamide
4-(1,3-dioxolan-2-yl)-N-[(1R,2S)-2-ethylsulfanylcyclohexyl]piperidine-1-carboxamide (PubChem CID 129397247) has the molecular formula C17H30N2O3S
and a molecular weight of 342.51 g/mol. Its IUPAC name is 4-(1,3-dioxolan-2-yl)-N-[(1R,2S)-2-ethylsulfanylcyclohexyl]piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(1,3-dioxolan-2-yl)-N-[(1R,2S)-2-ethylsulfanylcyclohexyl]piperidine-1-carboxamide |
| PubChem CID | 129397247 |
| Molecular Formula | C17H30N2O3S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 4-(1,3-dioxolan-2-yl)-N-[(1R,2S)-2-ethylsulfanylcyclohexyl]piperidine-1-carboxamide |
| SMILES | CCS[C@H]1CCCC[C@H]1NC(=O)N1CCC(C2OCCO2)CC1 |
| InChI | InChI=1S/C17H30N2O3S/c1-2-23-15-6-4-3-5-14(15)18-17(20)19-9-7-13(8-10-19)16-21-11-12-22-16/h13-16H,2-12H2,1H3,(H,18,20)/t14-,15+/m1/s1 |
| InChIKey | JCEWADSVOPCYIF-CABCVRRESA-N |
| XLogP | 2.85 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,3-dioxolan-2-yl)-N-[(1R,2S)-2-ethylsulfanylcyclohexyl]piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dioxolan-2-yl)-N-[(1R,2S)-2-ethylsulfanylcyclohexyl]piperidine-1-carboxamide?
The IUPAC name of 4-(1,3-dioxolan-2-yl)-N-[(1R,2S)-2-ethylsulfanylcyclohexyl]piperidine-1-carboxamide (CID 129397247) is 4-(1,3-dioxolan-2-yl)-N-[(1R,2S)-2-ethylsulfanylcyclohexyl]piperidine-1-carboxamide.
What is the SMILES notation for 4-(1,3-dioxolan-2-yl)-N-[(1R,2S)-2-ethylsulfanylcyclohexyl]piperidine-1-carboxamide?
The canonical SMILES for 4-(1,3-dioxolan-2-yl)-N-[(1R,2S)-2-ethylsulfanylcyclohexyl]piperidine-1-carboxamide is CCS[C@H]1CCCC[C@H]1NC(=O)N1CCC(C2OCCO2)CC1.
What is the InChIKey of 4-(1,3-dioxolan-2-yl)-N-[(1R,2S)-2-ethylsulfanylcyclohexyl]piperidine-1-carboxamide?
The InChIKey is JCEWADSVOPCYIF-CABCVRRESA-N. The full InChI is InChI=1S/C17H30N2O3S/c1-2-23-15-6-4-3-5-14(15)18-17(20)19-9-7-13(8-10-19)16-21-11-12-22-16/h13-16H,2-12H2,1H3,(H,18,20)/t14-,15+/m1/s1.
What are the key properties of 4-(1,3-dioxolan-2-yl)-N-[(1R,2S)-2-ethylsulfanylcyclohexyl]piperidine-1-carboxamide?
4-(1,3-dioxolan-2-yl)-N-[(1R,2S)-2-ethylsulfanylcyclohexyl]piperidine-1-carboxamide has a molecular weight of 342.51 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxolan-2-yl)-N-[(1R,2S)-2-ethylsulfanylcyclohexyl]piperidine-1-carboxamide is sourced from PubChem (CID 129397247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).