C15H27NO2S — CID 71861380
N-(2-ethylsulfanylcyclohexyl)-3-(oxolan-2-yl)propanamide (PubChem CID 71861380) has the molecular formula C15H27NO2S and a molecular weight of 285.45 g/mol. Its IUPAC name is N-(2-ethylsulfanylcyclohexyl)-3-(oxolan-2-yl)propanamide.
| Compound Name | N-(2-ethylsulfanylcyclohexyl)-3-(oxolan-2-yl)propanamide |
|---|---|
| PubChem CID | 71861380 |
| Molecular Formula | C15H27NO2S |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | N-(2-ethylsulfanylcyclohexyl)-3-(oxolan-2-yl)propanamide |
| SMILES | CCSC1CCCCC1NC(=O)CCC1CCCO1 |
| InChI | InChI=1S/C15H27NO2S/c1-2-19-14-8-4-3-7-13(14)16-15(17)10-9-12-6-5-11-18-12/h12-14H,2-11H2,1H3,(H,16,17) |
| InChIKey | WOBFDSAIMMODOB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |