C13H21NO3 — CID 65155572
N-(4-oxocyclohexyl)-3-(oxolan-2-yl)propanamide (PubChem CID 65155572) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is N-(4-oxocyclohexyl)-3-(oxolan-2-yl)propanamide.
| Compound Name | N-(4-oxocyclohexyl)-3-(oxolan-2-yl)propanamide |
|---|---|
| PubChem CID | 65155572 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-(4-oxocyclohexyl)-3-(oxolan-2-yl)propanamide |
| SMILES | O=C1CCC(NC(=O)CCC2CCCO2)CC1 |
| InChI | InChI=1S/C13H21NO3/c15-11-5-3-10(4-6-11)14-13(16)8-7-12-2-1-9-17-12/h10,12H,1-9H2,(H,14,16) |
| InChIKey | MANIBFAOMFOKDC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |