C18H28N2O4 — CID 167992949
2-cyclopropylidene-N-[(1R,2R,4R)-2-hydroxy-4-[3-(oxolan-2-yl)propanoylamino]cyclopentyl]propanamide (PubChem CID 167992949) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-cyclopropylidene-N-[(1R,2R,4R)-2-hydroxy-4-[3-(oxolan-2-yl)propanoylamino]cyclopentyl]propanamide.
| Compound Name | 2-cyclopropylidene-N-[(1R,2R,4R)-2-hydroxy-4-[3-(oxolan-2-yl)propanoylamino]cyclopentyl]propanamide |
|---|---|
| PubChem CID | 167992949 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-cyclopropylidene-N-[(1R,2R,4R)-2-hydroxy-4-[3-(oxolan-2-yl)propanoylamino]cyclopentyl]propanamide |
| SMILES | CC(C(=O)N[C@@H]1C[C@@H](NC(=O)CCC2CCCO2)C[C@H]1O)=C1CC1 |
| InChI | InChI=1S/C18H28N2O4/c1-11(12-4-5-12)18(23)20-15-9-13(10-16(15)21)19-17(22)7-6-14-3-2-8-24-14/h13-16,21H,2-10H2,1H3,(H,19,22)(H,20,23)/t13-,14?,15-,16-/m1/s1 |
| InChIKey | KZJOVTPBDWXODJ-QGAIPKOMSA-N |
| XLogP | 1.18 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|