C13H23NO3S — CID 113249263
ethyl 4-[(2-ethylsulfanylcyclopentyl)amino]-4-oxobutanoate (PubChem CID 113249263) has the molecular formula C13H23NO3S and a molecular weight of 273.40 g/mol. Its IUPAC name is ethyl 4-[(2-ethylsulfanylcyclopentyl)amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[(2-ethylsulfanylcyclopentyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 113249263 |
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | ethyl 4-[(2-ethylsulfanylcyclopentyl)amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NC1CCCC1SCC |
| InChI | InChI=1S/C13H23NO3S/c1-3-17-13(16)9-8-12(15)14-10-6-5-7-11(10)18-4-2/h10-11H,3-9H2,1-2H3,(H,14,15) |
| InChIKey | QYIFKKSMOIMFMO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |