C16H28N2OS — CID 103812899
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(2-ethylsulfanylcyclopentyl)acetamide (PubChem CID 103812899) has the molecular formula C16H28N2OS and a molecular weight of 296.48 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(2-ethylsulfanylcyclopentyl)acetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(2-ethylsulfanylcyclopentyl)acetamide |
|---|---|
| PubChem CID | 103812899 |
| Molecular Formula | C16H28N2OS |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-(2-ethylsulfanylcyclopentyl)acetamide |
| SMILES | CCSC1CCCC1NC(=O)CC1CC2CCC(C1)N2 |
| InChI | InChI=1S/C16H28N2OS/c1-2-20-15-5-3-4-14(15)18-16(19)10-11-8-12-6-7-13(9-11)17-12/h11-15,17H,2-10H2,1H3,(H,18,19) |
| InChIKey | DCPQQUHAESAYAQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |