C16H31ClN2OS — CID 119818870
N-(2-ethylsulfanylcyclopentyl)-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119818870) has the molecular formula C16H31ClN2OS and a molecular weight of 334.96 g/mol. Its IUPAC name is N-(2-ethylsulfanylcyclopentyl)-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-(2-ethylsulfanylcyclopentyl)-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119818870 |
| Molecular Formula | C16H31ClN2OS |
| Molecular Weight | 334.96 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N-(2-ethylsulfanylcyclopentyl)-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CCSC1CCCC1NC(=O)CC(C)C1CCNCC1.Cl |
| InChI | InChI=1S/C16H30N2OS.ClH/c1-3-20-15-6-4-5-14(15)18-16(19)11-12(2)13-7-9-17-10-8-13;/h12-15,17H,3-11H2,1-2H3,(H,18,19);1H |
| InChIKey | LXKIVCITRWNHCO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.96 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |