C17H23BrN2O3 — CID 129399167
2-[[(4S)-1-[2-(2-bromophenyl)acetyl]azepan-4-yl]-methylamino]acetic acid (PubChem CID 129399167) has the molecular formula C17H23BrN2O3 and a molecular weight of 383.29 g/mol. Its IUPAC name is 2-[[(4S)-1-[2-(2-bromophenyl)acetyl]azepan-4-yl]-methylamino]acetic acid.
| Compound Name | 2-[[(4S)-1-[2-(2-bromophenyl)acetyl]azepan-4-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 129399167 |
| Molecular Formula | C17H23BrN2O3 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 2-[[(4S)-1-[2-(2-bromophenyl)acetyl]azepan-4-yl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)[C@H]1CCCN(C(=O)Cc2ccccc2Br)CC1 |
| InChI | InChI=1S/C17H23BrN2O3/c1-19(12-17(22)23)14-6-4-9-20(10-8-14)16(21)11-13-5-2-3-7-15(13)18/h2-3,5,7,14H,4,6,8-12H2,1H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | WILYSCQPGINBFQ-AWEZNQCLSA-N |
| XLogP | 2.39 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |