C16H21BrN2O4 — CID 128973419
2-[[4-[2-(2-bromophenyl)acetyl]morpholin-2-yl]methyl-methylamino]acetic acid (PubChem CID 128973419) has the molecular formula C16H21BrN2O4 and a molecular weight of 385.26 g/mol. Its IUPAC name is 2-[[4-[2-(2-bromophenyl)acetyl]morpholin-2-yl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[4-[2-(2-bromophenyl)acetyl]morpholin-2-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 128973419 |
| Molecular Formula | C16H21BrN2O4 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 2-[[4-[2-(2-bromophenyl)acetyl]morpholin-2-yl]methyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)CC1CN(C(=O)Cc2ccccc2Br)CCO1 |
| InChI | InChI=1S/C16H21BrN2O4/c1-18(11-16(21)22)9-13-10-19(6-7-23-13)15(20)8-12-4-2-3-5-14(12)17/h2-5,13H,6-11H2,1H3,(H,21,22) |
| InChIKey | VQZJOSOANJFMDI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |