C16H28N2O4 — CID 129324174
2-[[(2S)-4-(2-cyclohexylacetyl)morpholin-2-yl]methyl-methylamino]acetic acid (PubChem CID 129324174) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-[[(2S)-4-(2-cyclohexylacetyl)morpholin-2-yl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[(2S)-4-(2-cyclohexylacetyl)morpholin-2-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 129324174 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-[[(2S)-4-(2-cyclohexylacetyl)morpholin-2-yl]methyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C[C@H]1CN(C(=O)CC2CCCCC2)CCO1 |
| InChI | InChI=1S/C16H28N2O4/c1-17(12-16(20)21)10-14-11-18(7-8-22-14)15(19)9-13-5-3-2-4-6-13/h13-14H,2-12H2,1H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | JPWMOWOKOPVONL-AWEZNQCLSA-N |
| XLogP | 1.20 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |