C17H20N2O4S — CID 129343303
2-[[(2R)-4-(1-benzothiophene-2-carbonyl)morpholin-2-yl]methyl-methylamino]acetic acid (PubChem CID 129343303) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-[[(2R)-4-(1-benzothiophene-2-carbonyl)morpholin-2-yl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[(2R)-4-(1-benzothiophene-2-carbonyl)morpholin-2-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 129343303 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-[[(2R)-4-(1-benzothiophene-2-carbonyl)morpholin-2-yl]methyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C[C@@H]1CN(C(=O)c2cc3ccccc3s2)CCO1 |
| InChI | InChI=1S/C17H20N2O4S/c1-18(11-16(20)21)9-13-10-19(6-7-23-13)17(22)15-8-12-4-2-3-5-14(12)24-15/h2-5,8,13H,6-7,9-11H2,1H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | WKGSHCNBBXLBMN-CYBMUJFWSA-N |
| XLogP | 1.76 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |