C15H17Cl2FN2O4 — CID 128992651
2-[[4-(2,4-dichloro-5-fluorobenzoyl)morpholin-2-yl]methyl-methylamino]acetic acid (PubChem CID 128992651) has the molecular formula C15H17Cl2FN2O4 and a molecular weight of 379.22 g/mol. Its IUPAC name is 2-[[4-(2,4-dichloro-5-fluorobenzoyl)morpholin-2-yl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[4-(2,4-dichloro-5-fluorobenzoyl)morpholin-2-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 128992651 |
| Molecular Formula | C15H17Cl2FN2O4 |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 2-[[4-(2,4-dichloro-5-fluorobenzoyl)morpholin-2-yl]methyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)CC1CN(C(=O)c2cc(F)c(Cl)cc2Cl)CCO1 |
| InChI | InChI=1S/C15H17Cl2FN2O4/c1-19(8-14(21)22)6-9-7-20(2-3-24-9)15(23)10-4-13(18)12(17)5-11(10)16/h4-5,9H,2-3,6-8H2,1H3,(H,21,22) |
| InChIKey | OSGBBMIDNRXHHJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|