C19H29N3O5 — CID 120607008
2-[[4-[2-[2-(dimethylamino)ethoxy]benzoyl]morpholin-2-yl]methyl-methylamino]acetic acid (PubChem CID 120607008) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-[[4-[2-[2-(dimethylamino)ethoxy]benzoyl]morpholin-2-yl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[4-[2-[2-(dimethylamino)ethoxy]benzoyl]morpholin-2-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 120607008 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 2-[[4-[2-[2-(dimethylamino)ethoxy]benzoyl]morpholin-2-yl]methyl-methylamino]acetic acid |
| SMILES | CN(C)CCOc1ccccc1C(=O)N1CCOC(CN(C)CC(=O)O)C1 |
| InChI | InChI=1S/C19H29N3O5/c1-20(2)8-10-27-17-7-5-4-6-16(17)19(25)22-9-11-26-15(13-22)12-21(3)14-18(23)24/h4-7,15H,8-14H2,1-3H3,(H,23,24) |
| InChIKey | JFVURYYDSFSDCK-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |