C16H21ClN2O5 — CID 120606962
2-[[4-(4-chloro-2-methoxybenzoyl)morpholin-2-yl]methyl-methylamino]acetic acid (PubChem CID 120606962) has the molecular formula C16H21ClN2O5 and a molecular weight of 356.81 g/mol. Its IUPAC name is 2-[[4-(4-chloro-2-methoxybenzoyl)morpholin-2-yl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[4-(4-chloro-2-methoxybenzoyl)morpholin-2-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 120606962 |
| Molecular Formula | C16H21ClN2O5 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-[[4-(4-chloro-2-methoxybenzoyl)morpholin-2-yl]methyl-methylamino]acetic acid |
| SMILES | COc1cc(Cl)ccc1C(=O)N1CCOC(CN(C)CC(=O)O)C1 |
| InChI | InChI=1S/C16H21ClN2O5/c1-18(10-15(20)21)8-12-9-19(5-6-24-12)16(22)13-4-3-11(17)7-14(13)23-2/h3-4,7,12H,5-6,8-10H2,1-2H3,(H,20,21) |
| InChIKey | SDCXVARNCXFRIV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |