C20H31N3O3 — CID 129476372
2-[[(4R)-1-[(2S)-2-[benzyl(methyl)amino]propanoyl]azepan-4-yl]-methylamino]acetic acid (PubChem CID 129476372) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-[[(4R)-1-[(2S)-2-[benzyl(methyl)amino]propanoyl]azepan-4-yl]-methylamino]acetic acid.
| Compound Name | 2-[[(4R)-1-[(2S)-2-[benzyl(methyl)amino]propanoyl]azepan-4-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 129476372 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 2-[[(4R)-1-[(2S)-2-[benzyl(methyl)amino]propanoyl]azepan-4-yl]-methylamino]acetic acid |
| SMILES | C[C@@H](C(=O)N1CCC[C@@H](N(C)CC(=O)O)CC1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C20H31N3O3/c1-16(21(2)14-17-8-5-4-6-9-17)20(26)23-12-7-10-18(11-13-23)22(3)15-19(24)25/h4-6,8-9,16,18H,7,10-15H2,1-3H3,(H,24,25)/t16-,18+/m0/s1 |
| InChIKey | PZFHABOBOAQCLQ-FUHWJXTLSA-N |
| XLogP | 1.90 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |