C18H25FN2O4 — CID 129399156
2-[[(4S)-1-[(2S)-2-(3-fluorophenoxy)propanoyl]azepan-4-yl]-methylamino]acetic acid (PubChem CID 129399156) has the molecular formula C18H25FN2O4 and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-[[(4S)-1-[(2S)-2-(3-fluorophenoxy)propanoyl]azepan-4-yl]-methylamino]acetic acid.
| Compound Name | 2-[[(4S)-1-[(2S)-2-(3-fluorophenoxy)propanoyl]azepan-4-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 129399156 |
| Molecular Formula | C18H25FN2O4 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-[[(4S)-1-[(2S)-2-(3-fluorophenoxy)propanoyl]azepan-4-yl]-methylamino]acetic acid |
| SMILES | C[C@H](Oc1cccc(F)c1)C(=O)N1CCC[C@H](N(C)CC(=O)O)CC1 |
| InChI | InChI=1S/C18H25FN2O4/c1-13(25-16-7-3-5-14(19)11-16)18(24)21-9-4-6-15(8-10-21)20(2)12-17(22)23/h3,5,7,11,13,15H,4,6,8-10,12H2,1-2H3,(H,22,23)/t13-,15-/m0/s1 |
| InChIKey | LBNINIHZFRPCMS-ZFWWWQNUSA-N |
| XLogP | 1.99 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |