C21H25ClN2O2 — CID 122042922
2-[[1-[[4-(4-chlorophenyl)phenyl]methyl]piperidin-4-yl]-methylamino]acetic acid (PubChem CID 122042922) has the molecular formula C21H25ClN2O2 and a molecular weight of 372.90 g/mol. Its IUPAC name is 2-[[1-[[4-(4-chlorophenyl)phenyl]methyl]piperidin-4-yl]-methylamino]acetic acid.
| Compound Name | 2-[[1-[[4-(4-chlorophenyl)phenyl]methyl]piperidin-4-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 122042922 |
| Molecular Formula | C21H25ClN2O2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-[[1-[[4-(4-chlorophenyl)phenyl]methyl]piperidin-4-yl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C1CCN(Cc2ccc(-c3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H25ClN2O2/c1-23(15-21(25)26)20-10-12-24(13-11-20)14-16-2-4-17(5-3-16)18-6-8-19(22)9-7-18/h2-9,20H,10-15H2,1H3,(H,25,26) |
| InChIKey | CAVVQRNOOXRLCC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |