C21H25ClN2O3 — CID 122043659
2-[[4-[[4-(4-chlorophenyl)phenyl]methyl]morpholin-2-yl]methyl-methylamino]acetic acid (PubChem CID 122043659) has the molecular formula C21H25ClN2O3 and a molecular weight of 388.90 g/mol. Its IUPAC name is 2-[[4-[[4-(4-chlorophenyl)phenyl]methyl]morpholin-2-yl]methyl-methylamino]acetic acid.
| Compound Name | 2-[[4-[[4-(4-chlorophenyl)phenyl]methyl]morpholin-2-yl]methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 122043659 |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-[[4-[[4-(4-chlorophenyl)phenyl]methyl]morpholin-2-yl]methyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)CC1CN(Cc2ccc(-c3ccc(Cl)cc3)cc2)CCO1 |
| InChI | InChI=1S/C21H25ClN2O3/c1-23(15-21(25)26)13-20-14-24(10-11-27-20)12-16-2-4-17(5-3-16)18-6-8-19(22)9-7-18/h2-9,20H,10-15H2,1H3,(H,25,26) |
| InChIKey | NFVJBDAPEZVDEV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |