C21H26N2O3S — CID 122043801
2-[methyl-[[4-[(4-phenylsulfanylphenyl)methyl]morpholin-2-yl]methyl]amino]acetic acid (PubChem CID 122043801) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 2-[methyl-[[4-[(4-phenylsulfanylphenyl)methyl]morpholin-2-yl]methyl]amino]acetic acid.
| Compound Name | 2-[methyl-[[4-[(4-phenylsulfanylphenyl)methyl]morpholin-2-yl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 122043801 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 2-[methyl-[[4-[(4-phenylsulfanylphenyl)methyl]morpholin-2-yl]methyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)CC1CN(Cc2ccc(Sc3ccccc3)cc2)CCO1 |
| InChI | InChI=1S/C21H26N2O3S/c1-22(16-21(24)25)14-18-15-23(11-12-26-18)13-17-7-9-20(10-8-17)27-19-5-3-2-4-6-19/h2-10,18H,11-16H2,1H3,(H,24,25) |
| InChIKey | BFVATFOREVJOAY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |