C20H25N3O3 — CID 122043791
2-[methyl-[[4-[(3-pyridin-2-ylphenyl)methyl]morpholin-2-yl]methyl]amino]acetic acid (PubChem CID 122043791) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[methyl-[[4-[(3-pyridin-2-ylphenyl)methyl]morpholin-2-yl]methyl]amino]acetic acid.
| Compound Name | 2-[methyl-[[4-[(3-pyridin-2-ylphenyl)methyl]morpholin-2-yl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 122043791 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-[methyl-[[4-[(3-pyridin-2-ylphenyl)methyl]morpholin-2-yl]methyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)CC1CN(Cc2cccc(-c3ccccn3)c2)CCO1 |
| InChI | InChI=1S/C20H25N3O3/c1-22(15-20(24)25)13-18-14-23(9-10-26-18)12-16-5-4-6-17(11-16)19-7-2-3-8-21-19/h2-8,11,18H,9-10,12-15H2,1H3,(H,24,25) |
| InChIKey | XBNUDEXYXWDUHH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |