C17H18N2O3 — CID 95866693
(2S)-4-[(3-pyridin-2-ylphenyl)methyl]morpholine-2-carboxylic acid (PubChem CID 95866693) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is (2S)-4-[(3-pyridin-2-ylphenyl)methyl]morpholine-2-carboxylic acid.
| Compound Name | (2S)-4-[(3-pyridin-2-ylphenyl)methyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 95866693 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (2S)-4-[(3-pyridin-2-ylphenyl)methyl]morpholine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(Cc2cccc(-c3ccccn3)c2)CCO1 |
| InChI | InChI=1S/C17H18N2O3/c20-17(21)16-12-19(8-9-22-16)11-13-4-3-5-14(10-13)15-6-1-2-7-18-15/h1-7,10,16H,8-9,11-12H2,(H,20,21)/t16-/m0/s1 |
| InChIKey | PRQLUKGPVBKRFV-INIZCTEOSA-N |
| XLogP | 2.03 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |