C20H24N2O2 — CID 146137457
3-[1-[(3-pyridin-2-ylphenyl)methyl]piperidin-3-yl]propanoic acid (PubChem CID 146137457) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 3-[1-[(3-pyridin-2-ylphenyl)methyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[1-[(3-pyridin-2-ylphenyl)methyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 146137457 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 3-[1-[(3-pyridin-2-ylphenyl)methyl]piperidin-3-yl]propanoic acid |
| SMILES | O=C(O)CCC1CCCN(Cc2cccc(-c3ccccn3)c2)C1 |
| InChI | InChI=1S/C20H24N2O2/c23-20(24)10-9-16-6-4-12-22(14-16)15-17-5-3-7-18(13-17)19-8-1-2-11-21-19/h1-3,5,7-8,11,13,16H,4,6,9-10,12,14-15H2,(H,23,24) |
| InChIKey | GBOJTTMYALBZGB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |