C21H21N3 — CID 95714571
2-[(2R)-1-[(3-pyridin-2-ylphenyl)methyl]pyrrolidin-2-yl]pyridine (PubChem CID 95714571) has the molecular formula C21H21N3 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-[(2R)-1-[(3-pyridin-2-ylphenyl)methyl]pyrrolidin-2-yl]pyridine.
| Compound Name | 2-[(2R)-1-[(3-pyridin-2-ylphenyl)methyl]pyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 95714571 |
| Molecular Formula | C21H21N3 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2-[(2R)-1-[(3-pyridin-2-ylphenyl)methyl]pyrrolidin-2-yl]pyridine |
| SMILES | c1ccc(-c2cccc(CN3CCC[C@@H]3c3ccccn3)c2)nc1 |
| InChI | InChI=1S/C21H21N3/c1-3-12-22-19(9-1)18-8-5-7-17(15-18)16-24-14-6-11-21(24)20-10-2-4-13-23-20/h1-5,7-10,12-13,15,21H,6,11,14,16H2/t21-/m1/s1 |
| InChIKey | FXNOQZBISJEMPZ-OAQYLSRUSA-N |
| XLogP | 4.48 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |