C13H15N3S — CID 95729061
4-[[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]methyl]-1,3-thiazole (PubChem CID 95729061) has the molecular formula C13H15N3S and a molecular weight of 245.35 g/mol. Its IUPAC name is 4-[[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 4-[[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 95729061 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 4-[[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]methyl]-1,3-thiazole |
| SMILES | c1ccc([C@@H]2CCCN2Cc2cscn2)nc1 |
| InChI | InChI=1S/C13H15N3S/c1-2-6-14-12(4-1)13-5-3-7-16(13)8-11-9-17-10-15-11/h1-2,4,6,9-10,13H,3,5,7-8H2/t13-/m0/s1 |
| InChIKey | SUKCDYLHSPUPDR-ZDUSSCGKSA-N |
| XLogP | 2.88 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |