C16H18N4S — CID 77097504
4-[[2-(1H-benzimidazol-2-yl)piperidin-1-yl]methyl]-1,3-thiazole (PubChem CID 77097504) has the molecular formula C16H18N4S and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-[[2-(1H-benzimidazol-2-yl)piperidin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 4-[[2-(1H-benzimidazol-2-yl)piperidin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 77097504 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-[[2-(1H-benzimidazol-2-yl)piperidin-1-yl]methyl]-1,3-thiazole |
| SMILES | c1ccc2[nH]c(C3CCCCN3Cc3cscn3)nc2c1 |
| InChI | InChI=1S/C16H18N4S/c1-2-6-14-13(5-1)18-16(19-14)15-7-3-4-8-20(15)9-12-10-21-11-17-12/h1-2,5-6,10-11,15H,3-4,7-9H2,(H,18,19) |
| InChIKey | AONCXLAMQOTCHV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |