C21H19N5O2S — CID 86806756
4-[[2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]methyl]-2-(3-nitrophenyl)-1,3-thiazole (PubChem CID 86806756) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is 4-[[2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]methyl]-2-(3-nitrophenyl)-1,3-thiazole.
| Compound Name | 4-[[2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]methyl]-2-(3-nitrophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 86806756 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 4-[[2-(1H-benzimidazol-2-yl)pyrrolidin-1-yl]methyl]-2-(3-nitrophenyl)-1,3-thiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2nc(CN3CCCC3c3nc4ccccc4[nH]3)cs2)c1 |
| InChI | InChI=1S/C21H19N5O2S/c27-26(28)16-6-3-5-14(11-16)21-22-15(13-29-21)12-25-10-4-9-19(25)20-23-17-7-1-2-8-18(17)24-20/h1-3,5-8,11,13,19H,4,9-10,12H2,(H,23,24) |
| InChIKey | SVBYJAAJDIDKLM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|