C17H22N4O2S — CID 120782034
3,3-dimethyl-1-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methyl]piperidin-4-amine (PubChem CID 120782034) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 3,3-dimethyl-1-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methyl]piperidin-4-amine.
| Compound Name | 3,3-dimethyl-1-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 120782034 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3,3-dimethyl-1-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methyl]piperidin-4-amine |
| SMILES | CC1(C)CN(Cc2csc(-c3cccc([N+](=O)[O-])c3)n2)CCC1N |
| InChI | InChI=1S/C17H22N4O2S/c1-17(2)11-20(7-6-15(17)18)9-13-10-24-16(19-13)12-4-3-5-14(8-12)21(22)23/h3-5,8,10,15H,6-7,9,11,18H2,1-2H3 |
| InChIKey | NQNMDUFFCWATRZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|