C15H16N4O3S — CID 75439268
1-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methyl]-1,4-diazepan-5-one (PubChem CID 75439268) has the molecular formula C15H16N4O3S and a molecular weight of 332.38 g/mol. Its IUPAC name is 1-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methyl]-1,4-diazepan-5-one.
| Compound Name | 1-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 75439268 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 1-[[2-(3-nitrophenyl)-1,3-thiazol-4-yl]methyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCN(Cc2csc(-c3cccc([N+](=O)[O-])c3)n2)CCN1 |
| InChI | InChI=1S/C15H16N4O3S/c20-14-4-6-18(7-5-16-14)9-12-10-23-15(17-12)11-2-1-3-13(8-11)19(21)22/h1-3,8,10H,4-7,9H2,(H,16,20) |
| InChIKey | FTWJRVVDCZGNPD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|