C20H20N4O2S — CID 6456473
4-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-2-phenyl-1,3-thiazole (PubChem CID 6456473) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 4-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-2-phenyl-1,3-thiazole.
| Compound Name | 4-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 6456473 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 4-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-2-phenyl-1,3-thiazole |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(Cc3csc(-c4ccccc4)n3)CC2)cc1 |
| InChI | InChI=1S/C20H20N4O2S/c25-24(26)19-8-6-18(7-9-19)23-12-10-22(11-13-23)14-17-15-27-20(21-17)16-4-2-1-3-5-16/h1-9,15H,10-14H2 |
| InChIKey | SPOACHSGUGAFBR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|