C18H20N6O2S — CID 18131838
4-[[4-(3-methyl-5-nitroimidazol-4-yl)piperazin-1-yl]methyl]-2-phenyl-1,3-thiazole (PubChem CID 18131838) has the molecular formula C18H20N6O2S and a molecular weight of 384.47 g/mol. Its IUPAC name is 4-[[4-(3-methyl-5-nitroimidazol-4-yl)piperazin-1-yl]methyl]-2-phenyl-1,3-thiazole.
| Compound Name | 4-[[4-(3-methyl-5-nitroimidazol-4-yl)piperazin-1-yl]methyl]-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 18131838 |
| Molecular Formula | C18H20N6O2S |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-[[4-(3-methyl-5-nitroimidazol-4-yl)piperazin-1-yl]methyl]-2-phenyl-1,3-thiazole |
| SMILES | Cn1cnc([N+](=O)[O-])c1N1CCN(Cc2csc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C18H20N6O2S/c1-21-13-19-16(24(25)26)18(21)23-9-7-22(8-10-23)11-15-12-27-17(20-15)14-5-3-2-4-6-14/h2-6,12-13H,7-11H2,1H3 |
| InChIKey | GVLKIDYTOFERNI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 80.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|