C16H18F3N5O3 — CID 34059892
1-(3-methyl-5-nitroimidazol-4-yl)-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 34059892) has the molecular formula C16H18F3N5O3 and a molecular weight of 385.35 g/mol. Its IUPAC name is 1-(3-methyl-5-nitroimidazol-4-yl)-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-(3-methyl-5-nitroimidazol-4-yl)-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 34059892 |
| Molecular Formula | C16H18F3N5O3 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-(3-methyl-5-nitroimidazol-4-yl)-4-[[4-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | Cn1cnc([N+](=O)[O-])c1N1CCN(Cc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H18F3N5O3/c1-21-11-20-14(24(25)26)15(21)23-8-6-22(7-9-23)10-12-2-4-13(5-3-12)27-16(17,18)19/h2-5,11H,6-10H2,1H3 |
| InChIKey | GWOMOWKSFCVWSF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|