C16H19N5O4 — CID 17408295
1-(1,3-benzodioxol-5-ylmethyl)-4-(3-methyl-5-nitroimidazol-4-yl)piperazine (PubChem CID 17408295) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-4-(3-methyl-5-nitroimidazol-4-yl)piperazine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-(3-methyl-5-nitroimidazol-4-yl)piperazine |
|---|---|
| PubChem CID | 17408295 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-(3-methyl-5-nitroimidazol-4-yl)piperazine |
| SMILES | Cn1cnc([N+](=O)[O-])c1N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C16H19N5O4/c1-18-10-17-15(21(22)23)16(18)20-6-4-19(5-7-20)9-12-2-3-13-14(8-12)25-11-24-13/h2-3,8,10H,4-7,9,11H2,1H3 |
| InChIKey | NARWRWSQFITVMR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 85.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|