C23H23ClN6O4 — CID 22534942
6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-[(4-chlorophenyl)methyl]-5-nitropyrimidin-4-amine (PubChem CID 22534942) has the molecular formula C23H23ClN6O4 and a molecular weight of 482.93 g/mol. Its IUPAC name is 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-[(4-chlorophenyl)methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-[(4-chlorophenyl)methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22534942 |
| Molecular Formula | C23H23ClN6O4 |
| Molecular Weight | 482.93 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-[(4-chlorophenyl)methyl]-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCc2ccc(Cl)cc2)ncnc1N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C23H23ClN6O4/c24-18-4-1-16(2-5-18)12-25-22-21(30(31)32)23(27-14-26-22)29-9-7-28(8-10-29)13-17-3-6-19-20(11-17)34-15-33-19/h1-6,11,14H,7-10,12-13,15H2,(H,25,26,27) |
| InChIKey | OYTGGNPIFQWWBR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.93 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|